C26H22O11S3 — CID 58214159
2-[4-(4-methoxy-3-sulfophenyl)phenoxy]-5-(4-methylphenyl)benzene-1,3-disulfonic acid (PubChem CID 58214159) has the molecular formula C26H22O11S3 and a molecular weight of 606.65 g/mol. Its IUPAC name is 2-[4-(4-methoxy-3-sulfophenyl)phenoxy]-5-(4-methylphenyl)benzene-1,3-disulfonic acid.
| Compound Name | 2-[4-(4-methoxy-3-sulfophenyl)phenoxy]-5-(4-methylphenyl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 58214159 |
| Molecular Formula | C26H22O11S3 |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.03 |
| IUPAC Name | 2-[4-(4-methoxy-3-sulfophenyl)phenoxy]-5-(4-methylphenyl)benzene-1,3-disulfonic acid |
| SMILES | COc1ccc(-c2ccc(Oc3c(S(=O)(=O)O)cc(-c4ccc(C)cc4)cc3S(=O)(=O)O)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C26H22O11S3/c1-16-3-5-18(6-4-16)20-14-24(39(30,31)32)26(25(15-20)40(33,34)35)37-21-10-7-17(8-11-21)19-9-12-22(36-2)23(13-19)38(27,28)29/h3-15H,1-2H3,(H,27,28,29)(H,30,31,32)(H,33,34,35) |
| InChIKey | GGHDWCWPFOWMEN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 181.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|