C30H24NO10S3+ — CID 3731444
2-methoxy-5-[1-phenyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]benzenesulfonic acid (PubChem CID 3731444) has the molecular formula C30H24NO10S3+ and a molecular weight of 654.72 g/mol. Its IUPAC name is 2-methoxy-5-[1-phenyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]benzenesulfonic acid.
| Compound Name | 2-methoxy-5-[1-phenyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 3731444 |
| Molecular Formula | C30H24NO10S3+ |
| Molecular Weight | 654.72 g/mol |
| Exact Mass | 654.06 |
| IUPAC Name | 2-methoxy-5-[1-phenyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]benzenesulfonic acid |
| SMILES | COc1ccc(-c2cc(-c3ccc(S(=O)(=O)O)cc3)[n+](-c3ccccc3)c(-c3ccc(S(=O)(=O)O)cc3)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C30H23NO10S3/c1-41-29-16-11-22(19-30(29)44(38,39)40)23-17-27(20-7-12-25(13-8-20)42(32,33)34)31(24-5-3-2-4-6-24)28(18-23)21-9-14-26(15-10-21)43(35,36)37/h2-19H,1H3,(H2-,32,33,34,35,36,37,38,39,40)/p+1 |
| InChIKey | SRDAMDPRZAHNGX-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 176.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|