C31H25NO10S3 — CID 3839670
5-[1-benzyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonate (PubChem CID 3839670) has the molecular formula C31H25NO10S3 and a molecular weight of 667.74 g/mol. Its IUPAC name is 5-[1-benzyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonate.
| Compound Name | 5-[1-benzyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 3839670 |
| Molecular Formula | C31H25NO10S3 |
| Molecular Weight | 667.74 g/mol |
| Exact Mass | 667.06 |
| IUPAC Name | 5-[1-benzyl-2,6-bis(4-sulfophenyl)pyridin-1-ium-4-yl]-2-methoxybenzenesulfonate |
| SMILES | COc1ccc(-c2cc(-c3ccc(S(=O)(=O)O)cc3)[n+](Cc3ccccc3)c(-c3ccc(S(=O)(=O)O)cc3)c2)cc1S(=O)(=O)[O-] |
| InChI | InChI=1S/C31H25NO10S3/c1-42-30-16-11-24(19-31(30)45(39,40)41)25-17-28(22-7-12-26(13-8-22)43(33,34)35)32(20-21-5-3-2-4-6-21)29(18-25)23-9-14-27(15-10-23)44(36,37)38/h2-19H,20H2,1H3,(H2-,33,34,35,36,37,38,39,40,41) |
| InChIKey | QRRSHCUPXQQHRA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.74 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|