C30H31N2O12S3+ — CID 3535696
2-amino-6-[4-(4-methoxy-3-sulfophenyl)-2,6-bis(4-sulfophenyl)pyridin-1-ium-1-yl]hexanoic acid (PubChem CID 3535696) has the molecular formula C30H31N2O12S3+ and a molecular weight of 707.78 g/mol. Its IUPAC name is 2-amino-6-[4-(4-methoxy-3-sulfophenyl)-2,6-bis(4-sulfophenyl)pyridin-1-ium-1-yl]hexanoic acid.
| Compound Name | 2-amino-6-[4-(4-methoxy-3-sulfophenyl)-2,6-bis(4-sulfophenyl)pyridin-1-ium-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 3535696 |
| Molecular Formula | C30H31N2O12S3+ |
| Molecular Weight | 707.78 g/mol |
| Exact Mass | 707.10 |
| IUPAC Name | 2-amino-6-[4-(4-methoxy-3-sulfophenyl)-2,6-bis(4-sulfophenyl)pyridin-1-ium-1-yl]hexanoic acid |
| SMILES | COc1ccc(-c2cc(-c3ccc(S(=O)(=O)O)cc3)[n+](CCCCC(N)C(=O)O)c(-c3ccc(S(=O)(=O)O)cc3)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C30H30N2O12S3/c1-44-28-14-9-21(18-29(28)47(41,42)43)22-16-26(19-5-10-23(11-6-19)45(35,36)37)32(15-3-2-4-25(31)30(33)34)27(17-22)20-7-12-24(13-8-20)46(38,39)40/h5-14,16-18,25H,2-4,15,31H2,1H3,(H3-,33,34,35,36,37,38,39,40,41,42,43)/p+1 |
| InChIKey | ZHKXXVXVYNEQOZ-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 239.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|