C31H26F3NO5S — CID 44888385
methyl 2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)acetate;trifluoromethanesulfonate (PubChem CID 44888385) has the molecular formula C31H26F3NO5S and a molecular weight of 581.61 g/mol. Its IUPAC name is methyl 2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)acetate;trifluoromethanesulfonate.
| Compound Name | methyl 2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)acetate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 44888385 |
| Molecular Formula | C31H26F3NO5S |
| Molecular Weight | 581.61 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | methyl 2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)acetate;trifluoromethanesulfonate |
| SMILES | COC(=O)C[n+]1c2c(c(-c3ccccc3)c3c1-c1ccccc1CC3)CCc1ccccc1-2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C30H26NO2.CHF3O3S/c1-33-27(32)19-31-29-23-13-7-5-9-20(23)15-17-25(29)28(22-11-3-2-4-12-22)26-18-16-21-10-6-8-14-24(21)30(26)31;2-1(3,4)8(5,6)7/h2-14H,15-19H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SOZOUKJMDPPBPZ-UHFFFAOYSA-M |
| XLogP | 5.40 |
| TPSA | 87.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|