C42H39BF4N2O2 — CID 170780664
tert-butyl 3-[2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)ethyl]indole-1-carboxylate tetrafluoroborate (PubChem CID 170780664) has the molecular formula C42H39BF4N2O2 and a molecular weight of 690.59 g/mol. Its IUPAC name is tert-butyl 3-[2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)ethyl]indole-1-carboxylate tetrafluoroborate.
| Compound Name | tert-butyl 3-[2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)ethyl]indole-1-carboxylate tetrafluoroborate |
|---|---|
| PubChem CID | 170780664 |
| Molecular Formula | C42H39BF4N2O2 |
| Molecular Weight | 690.59 g/mol |
| Exact Mass | 690.30 |
| IUPAC Name | tert-butyl 3-[2-(13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaen-2-yl)ethyl]indole-1-carboxylate tetrafluoroborate |
| SMILES | CC(C)(C)OC(=O)n1cc(CC[n+]2c3c(c(-c4ccccc4)c4c2-c2ccccc2CC4)CCc2ccccc2-3)c2ccccc21.F[B-](F)(F)F |
| InChI | InChI=1S/C42H39N2O2.BF4/c1-42(2,3)46-41(45)44-27-31(32-17-11-12-20-37(32)44)25-26-43-39-33-18-9-7-13-28(33)21-23-35(39)38(30-15-5-4-6-16-30)36-24-22-29-14-8-10-19-34(29)40(36)43;2-1(3,4)5/h4-20,27H,21-26H2,1-3H3;/q+1;-1 |
| InChIKey | IUEKPYXPXDOJLL-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.59 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|