C29H26BF4NO2 — CID 12842371
ethyl 2-(2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium-1-yl)acetate tetrafluoroborate (PubChem CID 12842371) has the molecular formula C29H26BF4NO2 and a molecular weight of 507.34 g/mol. Its IUPAC name is ethyl 2-(2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium-1-yl)acetate tetrafluoroborate.
| Compound Name | ethyl 2-(2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium-1-yl)acetate tetrafluoroborate |
|---|---|
| PubChem CID | 12842371 |
| Molecular Formula | C29H26BF4NO2 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | ethyl 2-(2,4-diphenyl-5,6-dihydrobenzo[h]quinolin-1-ium-1-yl)acetate tetrafluoroborate |
| SMILES | CCOC(=O)C[n+]1c(-c2ccccc2)cc(-c2ccccc2)c2c1-c1ccccc1CC2.F[B-](F)(F)F |
| InChI | InChI=1S/C29H26NO2.BF4/c1-2-32-28(31)20-30-27(23-14-7-4-8-15-23)19-26(21-11-5-3-6-12-21)25-18-17-22-13-9-10-16-24(22)29(25)30;2-1(3,4)5/h3-16,19H,2,17-18,20H2,1H3;/q+1;-1 |
| InChIKey | XVCXEQPEYKJKEM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|