C34H34F3NO3S — CID 12656061
2-hexyl-13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate (PubChem CID 12656061) has the molecular formula C34H34F3NO3S and a molecular weight of 593.71 g/mol. Its IUPAC name is 2-hexyl-13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate.
| Compound Name | 2-hexyl-13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12656061 |
| Molecular Formula | C34H34F3NO3S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 2-hexyl-13-phenyl-2-azoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,17,19,21-nonaene;trifluoromethanesulfonate |
| SMILES | CCCCCC[n+]1c2c(c(-c3ccccc3)c3c1-c1ccccc1CC3)CCc1ccccc1-2.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C33H34N.CHF3O3S/c1-2-3-4-12-23-34-32-27-17-10-8-13-24(27)19-21-29(32)31(26-15-6-5-7-16-26)30-22-20-25-14-9-11-18-28(25)33(30)34;2-1(3,4)8(5,6)7/h5-11,13-18H,2-4,12,19-23H2,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | BABNVMWDHLEVOD-UHFFFAOYSA-M |
| XLogP | 7.80 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|