C26H21ClO9S — CID 44888175
2-methoxy-5-(2-phenyl-5,6-dihydrobenzo[h]chromen-1-ium-4-yl)benzenesulfonic acid perchlorate (PubChem CID 44888175) has the molecular formula C26H21ClO9S and a molecular weight of 544.97 g/mol. Its IUPAC name is 2-methoxy-5-(2-phenyl-5,6-dihydrobenzo[h]chromen-1-ium-4-yl)benzenesulfonic acid perchlorate.
| Compound Name | 2-methoxy-5-(2-phenyl-5,6-dihydrobenzo[h]chromen-1-ium-4-yl)benzenesulfonic acid perchlorate |
|---|---|
| PubChem CID | 44888175 |
| Molecular Formula | C26H21ClO9S |
| Molecular Weight | 544.97 g/mol |
| Exact Mass | 544.06 |
| IUPAC Name | 2-methoxy-5-(2-phenyl-5,6-dihydrobenzo[h]chromen-1-ium-4-yl)benzenesulfonic acid perchlorate |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[o+]c3c2CCc2ccccc2-3)cc1S(=O)(=O)O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C26H20O5S.ClHO4/c1-30-23-14-12-19(15-25(23)32(27,28)29)22-16-24(18-8-3-2-4-9-18)31-26-20-10-6-5-7-17(20)11-13-21(22)26;2-1(3,4)5/h2-10,12,14-16H,11,13H2,1H3;(H,2,3,4,5) |
| InChIKey | KWZCHZQYOCYDKN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 167.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.97 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|