C35H26Cl2O11 — CID 44889744
7-(2,6-diphenylpyrylium-4-yl)-3-methoxy-5,6-dihydrobenzo[c]xanthen-12-ium diperchlorate (PubChem CID 44889744) has the molecular formula C35H26Cl2O11 and a molecular weight of 693.49 g/mol. Its IUPAC name is 7-(2,6-diphenylpyrylium-4-yl)-3-methoxy-5,6-dihydrobenzo[c]xanthen-12-ium diperchlorate.
| Compound Name | 7-(2,6-diphenylpyrylium-4-yl)-3-methoxy-5,6-dihydrobenzo[c]xanthen-12-ium diperchlorate |
|---|---|
| PubChem CID | 44889744 |
| Molecular Formula | C35H26Cl2O11 |
| Molecular Weight | 693.49 g/mol |
| Exact Mass | 692.09 |
| IUPAC Name | 7-(2,6-diphenylpyrylium-4-yl)-3-methoxy-5,6-dihydrobenzo[c]xanthen-12-ium diperchlorate |
| SMILES | COc1ccc2c(c1)CCc1c-2[o+]c2ccccc2c1-c1cc(-c2ccccc2)[o+]c(-c2ccccc2)c1.[O-][Cl+3]([O-])([O-])[O-].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C35H26O3.2ClHO4/c1-36-27-17-19-28-25(20-27)16-18-30-34(29-14-8-9-15-31(29)38-35(28)30)26-21-32(23-10-4-2-5-11-23)37-33(22-26)24-12-6-3-7-13-24;2*2-1(3,4)5/h2-15,17,19-22H,16,18H2,1H3;2*(H,2,3,4,5)/q+2;;/p-2 |
| InChIKey | LLKOQRQNGJVNIN-UHFFFAOYSA-L |
| XLogP | -0.15 |
| TPSA | 216.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.49 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|