C29H23ClO5 — CID 134911741
6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium perchlorate (PubChem CID 134911741) has the molecular formula C29H23ClO5 and a molecular weight of 486.95 g/mol. Its IUPAC name is 6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium perchlorate.
| Compound Name | 6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium perchlorate |
|---|---|
| PubChem CID | 134911741 |
| Molecular Formula | C29H23ClO5 |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium perchlorate |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)[o+]c3ccc(C)cc23)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H23O.ClHO4/c1-20-13-16-23(17-14-20)27-25-19-21(2)15-18-26(25)30-29(24-11-7-4-8-12-24)28(27)22-9-5-3-6-10-22;2-1(3,4)5/h3-19H,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | UGWSXDUJNPOULR-UHFFFAOYSA-M |
| XLogP | 3.58 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|