C29H23O+ — CID 134911742
6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium (PubChem CID 134911742) has the molecular formula C29H23O+ and a molecular weight of 387.50 g/mol. Its IUPAC name is 6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium.
| Compound Name | 6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium |
|---|---|
| PubChem CID | 134911742 |
| Molecular Formula | C29H23O+ |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6-methyl-4-(4-methylphenyl)-2,3-diphenylchromenylium |
| SMILES | Cc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)[o+]c3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C29H23O/c1-20-13-16-23(17-14-20)27-25-19-21(2)15-18-26(25)30-29(24-11-7-4-8-12-24)28(27)22-9-5-3-6-10-22/h3-19H,1-2H3/q+1 |
| InChIKey | ATRXBZVBUYWDQD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|