C30H23O+ — CID 3459815
4-(4-methylphenyl)-2,3,6-triphenylpyrylium (PubChem CID 3459815) has the molecular formula C30H23O+ and a molecular weight of 399.51 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,3,6-triphenylpyrylium.
| Compound Name | 4-(4-methylphenyl)-2,3,6-triphenylpyrylium |
|---|---|
| PubChem CID | 3459815 |
| Molecular Formula | C30H23O+ |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-(4-methylphenyl)-2,3,6-triphenylpyrylium |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)[o+]c(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H23O/c1-22-17-19-23(20-18-22)27-21-28(24-11-5-2-6-12-24)31-30(26-15-9-4-10-16-26)29(27)25-13-7-3-8-14-25/h2-21H,1H3/q+1 |
| InChIKey | KNUMCDJISXCXHL-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|