C33H23O+ — CID 90472342
4,6-diphenyl-2-(4-phenylphenyl)chromenylium (PubChem CID 90472342) has the molecular formula C33H23O+ and a molecular weight of 435.55 g/mol. Its IUPAC name is 4,6-diphenyl-2-(4-phenylphenyl)chromenylium.
| Compound Name | 4,6-diphenyl-2-(4-phenylphenyl)chromenylium |
|---|---|
| PubChem CID | 90472342 |
| Molecular Formula | C33H23O+ |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4,6-diphenyl-2-(4-phenylphenyl)chromenylium |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccccc4)c4cc(-c5ccccc5)ccc4[o+]3)cc2)cc1 |
| InChI | InChI=1S/C33H23O/c1-4-10-24(11-5-1)26-16-18-28(19-17-26)33-23-30(27-14-8-3-9-15-27)31-22-29(20-21-32(31)34-33)25-12-6-2-7-13-25/h1-23H/q+1 |
| InChIKey | JRRYRGNNWBIAIP-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|