C24H17ClO6 — CID 14343704
2,4,6-triphenylpyrylium-3-carbaldehyde perchlorate (PubChem CID 14343704) has the molecular formula C24H17ClO6 and a molecular weight of 436.85 g/mol. Its IUPAC name is 2,4,6-triphenylpyrylium-3-carbaldehyde perchlorate.
| Compound Name | 2,4,6-triphenylpyrylium-3-carbaldehyde perchlorate |
|---|---|
| PubChem CID | 14343704 |
| Molecular Formula | C24H17ClO6 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | 2,4,6-triphenylpyrylium-3-carbaldehyde perchlorate |
| SMILES | O=Cc1c(-c2ccccc2)cc(-c2ccccc2)[o+]c1-c1ccccc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C24H17O2.ClHO4/c25-17-22-21(18-10-4-1-5-11-18)16-23(19-12-6-2-7-13-19)26-24(22)20-14-8-3-9-15-20;2-1(3,4)5/h1-17H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CPJADJRLKZYWRK-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 120.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|