C21H14Cl2O6 — CID 134909283
2-(5-chlorofuran-2-yl)-4,6-diphenylpyrylium perchlorate (PubChem CID 134909283) has the molecular formula C21H14Cl2O6 and a molecular weight of 433.24 g/mol. Its IUPAC name is 2-(5-chlorofuran-2-yl)-4,6-diphenylpyrylium perchlorate.
| Compound Name | 2-(5-chlorofuran-2-yl)-4,6-diphenylpyrylium perchlorate |
|---|---|
| PubChem CID | 134909283 |
| Molecular Formula | C21H14Cl2O6 |
| Molecular Weight | 433.24 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2-(5-chlorofuran-2-yl)-4,6-diphenylpyrylium perchlorate |
| SMILES | Clc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)[o+]2)o1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C21H14ClO2.ClHO4/c22-21-12-11-18(24-21)20-14-17(15-7-3-1-4-8-15)13-19(23-20)16-9-5-2-6-10-16;2-1(3,4)5/h1-14H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XODQMZSLJDHWKK-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 116.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|