C21H14BrO2+ — CID 14173693
2-(5-bromofuran-2-yl)-4,6-diphenylpyrylium (PubChem CID 14173693) has the molecular formula C21H14BrO2+ and a molecular weight of 378.25 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-4,6-diphenylpyrylium.
| Compound Name | 2-(5-bromofuran-2-yl)-4,6-diphenylpyrylium |
|---|---|
| PubChem CID | 14173693 |
| Molecular Formula | C21H14BrO2+ |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-4,6-diphenylpyrylium |
| SMILES | Brc1ccc(-c2cc(-c3ccccc3)cc(-c3ccccc3)[o+]2)o1 |
| InChI | InChI=1S/C21H14BrO2/c22-21-12-11-18(24-21)20-14-17(15-7-3-1-4-8-15)13-19(23-20)16-9-5-2-6-10-16/h1-14H/q+1 |
| InChIKey | NGXHKWAVVKPTFA-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 24.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|