About 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol
4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol (PubChem CID 6033287) has the molecular formula C31H23O2+
and a molecular weight of 427.52 g/mol. Its IUPAC name is 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol.
Molecular Properties
| Compound Name | 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol |
| PubChem CID | 6033287 |
| Molecular Formula | C31H23O2+ |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol |
| SMILES | Oc1ccc(/C=C/c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)[o+]3)cc2)cc1 |
| InChI | InChI=1S/C31H22O2/c32-29-19-15-24(16-20-29)12-11-23-13-17-27(18-14-23)31-22-28(25-7-3-1-4-8-25)21-30(33-31)26-9-5-2-6-10-26/h1-22H/p+1/b12-11+ |
| InChIKey | GRCMPWDXDVUTIZ-VAWYXSNFSA-O |
| XLogP | 8.44 |
| TPSA | 31.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol?
The IUPAC name of 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol (CID 6033287) is 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol.
What is the SMILES notation for 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol?
The canonical SMILES for 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol is Oc1ccc(/C=C/c2ccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)[o+]3)cc2)cc1.
What is the InChIKey of 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol?
The InChIKey is GRCMPWDXDVUTIZ-VAWYXSNFSA-O. The full InChI is InChI=1S/C31H22O2/c32-29-19-15-24(16-20-29)12-11-23-13-17-27(18-14-23)31-22-28(25-7-3-1-4-8-25)21-30(33-31)26-9-5-2-6-10-26/h1-22H/p+1/b12-11+.
What are the key properties of 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol?
4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol has a molecular weight of 427.52 g/mol, XLogP of 8.44, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[4-(4,6-diphenylpyrylium-2-yl)phenyl]ethenyl]phenol is sourced from PubChem (CID 6033287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).