About 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol
2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol (PubChem CID 4109867) has the molecular formula C25H19O2+
and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol.
Molecular Properties
| Compound Name | 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol |
| PubChem CID | 4109867 |
| Molecular Formula | C25H19O2+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol |
| SMILES | Oc1ccccc1C=Cc1cc(-c2ccccc2)cc(-c2ccccc2)[o+]1 |
| InChI | InChI=1S/C25H18O2/c26-24-14-8-7-11-20(24)15-16-23-17-22(19-9-3-1-4-10-19)18-25(27-23)21-12-5-2-6-13-21/h1-18H/p+1 |
| InChIKey | LTOYPQISYWCJSB-UHFFFAOYSA-O |
| XLogP | 6.77 |
| TPSA | 31.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol?
The IUPAC name of 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol (CID 4109867) is 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol.
What is the SMILES notation for 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol?
The canonical SMILES for 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol is Oc1ccccc1C=Cc1cc(-c2ccccc2)cc(-c2ccccc2)[o+]1.
What is the InChIKey of 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol?
The InChIKey is LTOYPQISYWCJSB-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H18O2/c26-24-14-8-7-11-20(24)15-16-23-17-22(19-9-3-1-4-10-19)18-25(27-23)21-12-5-2-6-13-21/h1-18H/p+1.
What are the key properties of 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol?
2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol has a molecular weight of 351.43 g/mol, XLogP of 6.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,6-diphenylpyrylium-2-yl)ethenyl]phenol is sourced from PubChem (CID 4109867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).