C56H36O2+2 — CID 101141044
4-[4-(2,6-dinaphthalen-2-ylpyrylium-4-yl)phenyl]-2,6-dinaphthalen-2-ylpyrylium (PubChem CID 101141044) has the molecular formula C56H36O2+2 and a molecular weight of 740.90 g/mol. Its IUPAC name is 4-[4-(2,6-dinaphthalen-2-ylpyrylium-4-yl)phenyl]-2,6-dinaphthalen-2-ylpyrylium.
| Compound Name | 4-[4-(2,6-dinaphthalen-2-ylpyrylium-4-yl)phenyl]-2,6-dinaphthalen-2-ylpyrylium |
|---|---|
| PubChem CID | 101141044 |
| Molecular Formula | C56H36O2+2 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 4-[4-(2,6-dinaphthalen-2-ylpyrylium-4-yl)phenyl]-2,6-dinaphthalen-2-ylpyrylium |
| SMILES | c1ccc2cc(-c3cc(-c4ccc(-c5cc(-c6ccc7ccccc7c6)[o+]c(-c6ccc7ccccc7c6)c5)cc4)cc(-c4ccc5ccccc5c4)[o+]3)ccc2c1 |
| InChI | InChI=1S/C56H36O2/c1-5-13-43-29-47(25-21-37(43)9-1)53-33-51(34-54(57-53)48-26-22-38-10-2-6-14-44(38)30-48)41-17-19-42(20-18-41)52-35-55(49-27-23-39-11-3-7-15-45(39)31-49)58-56(36-52)50-28-24-40-12-4-8-16-46(40)32-50/h1-36H/q+2 |
| InChIKey | XLCRYZMOVJXTID-UHFFFAOYSA-N |
| XLogP | 16.05 |
| TPSA | 22.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 16.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|