C23H14Br3O+ — CID 11365661
2,4,6-tris(4-bromophenyl)pyrylium (PubChem CID 11365661) has the molecular formula C23H14Br3O+ and a molecular weight of 546.08 g/mol. Its IUPAC name is 2,4,6-tris(4-bromophenyl)pyrylium.
| Compound Name | 2,4,6-tris(4-bromophenyl)pyrylium |
|---|---|
| PubChem CID | 11365661 |
| Molecular Formula | C23H14Br3O+ |
| Molecular Weight | 546.08 g/mol |
| Exact Mass | 542.86 |
| IUPAC Name | 2,4,6-tris(4-bromophenyl)pyrylium |
| SMILES | Brc1ccc(-c2cc(-c3ccc(Br)cc3)[o+]c(-c3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C23H14Br3O/c24-19-7-1-15(2-8-19)18-13-22(16-3-9-20(25)10-4-16)27-23(14-18)17-5-11-21(26)12-6-17/h1-14H/q+1 |
| InChIKey | PSDUPYIQUORZGL-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.08 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|