C27H23ClO8 — CID 11135007
9-(2,6-diphenylpyrylium-4-yl)-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine perchlorate (PubChem CID 11135007) has the molecular formula C27H23ClO8 and a molecular weight of 510.93 g/mol. Its IUPAC name is 9-(2,6-diphenylpyrylium-4-yl)-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine perchlorate.
| Compound Name | 9-(2,6-diphenylpyrylium-4-yl)-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine perchlorate |
|---|---|
| PubChem CID | 11135007 |
| Molecular Formula | C27H23ClO8 |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 9-(2,6-diphenylpyrylium-4-yl)-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc(-c3ccc4c(c3)OCCOCCO4)cc(-c3ccccc3)[o+]2)cc1 |
| InChI | InChI=1S/C27H23O4.ClHO4/c1-3-7-20(8-4-1)25-18-23(19-26(31-25)21-9-5-2-6-10-21)22-11-12-24-27(17-22)30-16-14-28-13-15-29-24;2-1(3,4)5/h1-12,17-19H,13-16H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WJUKJHLLWNDRBG-UHFFFAOYSA-M |
| XLogP | 1.59 |
| TPSA | 131.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|