C16H11ClO7 — CID 135052938
2-(1,3-benzodioxol-5-yl)chromenylium perchlorate (PubChem CID 135052938) has the molecular formula C16H11ClO7 and a molecular weight of 350.71 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)chromenylium perchlorate.
| Compound Name | 2-(1,3-benzodioxol-5-yl)chromenylium perchlorate |
|---|---|
| PubChem CID | 135052938 |
| Molecular Formula | C16H11ClO7 |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)chromenylium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc2[o+]c(-c3ccc4c(c3)OCO4)ccc2c1 |
| InChI | InChI=1S/C16H11O3.ClHO4/c1-2-4-13-11(3-1)5-7-14(19-13)12-6-8-15-16(9-12)18-10-17-15;2-1(3,4)5/h1-9H,10H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | XUESENPZPRJPIR-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|