About 2-phenylchromenylium
2-phenylchromenylium (PubChem CID 159562545) has the molecular formula C30H22O2+2
and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-phenylchromenylium.
Molecular Properties
| Compound Name | 2-phenylchromenylium |
| PubChem CID | 159562545 |
| Molecular Formula | C30H22O2+2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-phenylchromenylium |
| SMILES | c1ccc(-c2ccc3ccccc3[o+]2)cc1.c1ccc(-c2ccc3ccccc3[o+]2)cc1 |
| InChI | InChI=1S/2C15H11O/c2*1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h2*1-11H/q2*+1 |
| InChIKey | MGUOEGFCOIFGHS-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 22.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylchromenylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylchromenylium?
The IUPAC name of 2-phenylchromenylium (CID 159562545) is 2-phenylchromenylium.
What is the SMILES notation for 2-phenylchromenylium?
The canonical SMILES for 2-phenylchromenylium is c1ccc(-c2ccc3ccccc3[o+]2)cc1.c1ccc(-c2ccc3ccccc3[o+]2)cc1.
What is the InChIKey of 2-phenylchromenylium?
The InChIKey is MGUOEGFCOIFGHS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H11O/c2*1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h2*1-11H/q2*+1.
What are the key properties of 2-phenylchromenylium?
2-phenylchromenylium has a molecular weight of 414.50 g/mol, XLogP of 8.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylchromenylium is sourced from PubChem (CID 159562545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).