About 2-phenylchromenylium;hydrate
2-phenylchromenylium;hydrate (PubChem CID 172755683) has the molecular formula C15H13O2+
and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-phenylchromenylium;hydrate.
Molecular Properties
| Compound Name | 2-phenylchromenylium;hydrate |
| PubChem CID | 172755683 |
| Molecular Formula | C15H13O2+ |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-phenylchromenylium;hydrate |
| SMILES | O.c1ccc(-c2ccc3ccccc3[o+]2)cc1 |
| InChI | InChI=1S/C15H11O.H2O/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;/h1-11H;1H2/q+1; |
| InChIKey | KZIRPEZTSAXXHK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylchromenylium;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylchromenylium;hydrate?
The IUPAC name of 2-phenylchromenylium;hydrate (CID 172755683) is 2-phenylchromenylium;hydrate.
What is the SMILES notation for 2-phenylchromenylium;hydrate?
The canonical SMILES for 2-phenylchromenylium;hydrate is O.c1ccc(-c2ccc3ccccc3[o+]2)cc1.
What is the InChIKey of 2-phenylchromenylium;hydrate?
The InChIKey is KZIRPEZTSAXXHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11O.H2O/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;/h1-11H;1H2/q+1;.
What are the key properties of 2-phenylchromenylium;hydrate?
2-phenylchromenylium;hydrate has a molecular weight of 225.27 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylchromenylium;hydrate is sourced from PubChem (CID 172755683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).