C14H13O+ — CID 134910928
2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyran-1-ium (PubChem CID 134910928) has the molecular formula C14H13O+ and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyran-1-ium.
| Compound Name | 2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyran-1-ium |
|---|---|
| PubChem CID | 134910928 |
| Molecular Formula | C14H13O+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-phenyl-6,7-dihydro-5H-cyclopenta[b]pyran-1-ium |
| SMILES | c1ccc(-c2ccc3c([o+]2)CCC3)cc1 |
| InChI | InChI=1S/C14H13O/c1-2-5-11(6-3-1)14-10-9-12-7-4-8-13(12)15-14/h1-3,5-6,9-10H,4,7-8H2/q+1 |
| InChIKey | LDWGUVGMBMPSII-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|