C22H19O3+ — CID 12943621
4-(4-methoxyphenyl)-2-phenyl-7,8-dihydro-6H-chromen-1-ium-5-one (PubChem CID 12943621) has the molecular formula C22H19O3+ and a molecular weight of 331.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-phenyl-7,8-dihydro-6H-chromen-1-ium-5-one.
| Compound Name | 4-(4-methoxyphenyl)-2-phenyl-7,8-dihydro-6H-chromen-1-ium-5-one |
|---|---|
| PubChem CID | 12943621 |
| Molecular Formula | C22H19O3+ |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-phenyl-7,8-dihydro-6H-chromen-1-ium-5-one |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)[o+]c3c2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C22H19O3/c1-24-17-12-10-15(11-13-17)18-14-21(16-6-3-2-4-7-16)25-20-9-5-8-19(23)22(18)20/h2-4,6-7,10-14H,5,8-9H2,1H3/q+1 |
| InChIKey | HMADWCNMKZGAFP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|