C16H15NO2 — CID 6463228
4-(4-methoxyphenyl)-7,8-dihydro-6H-quinolin-5-one (PubChem CID 6463228) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-7,8-dihydro-6H-quinolin-5-one.
| Compound Name | 4-(4-methoxyphenyl)-7,8-dihydro-6H-quinolin-5-one |
|---|---|
| PubChem CID | 6463228 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-(4-methoxyphenyl)-7,8-dihydro-6H-quinolin-5-one |
| SMILES | COc1ccc(-c2ccnc3c2C(=O)CCC3)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-19-12-7-5-11(6-8-12)13-9-10-17-14-3-2-4-15(18)16(13)14/h5-10H,2-4H2,1H3 |
| InChIKey | GPEPTCOZYWRIIF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |