C35H35O10+ — CID 102211345
9-[2,6-bis(2,3,5,6-tetrahydro-1,4,7-benzotrioxonin-9-yl)pyrylium-4-yl]-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine (PubChem CID 102211345) has the molecular formula C35H35O10+ and a molecular weight of 615.65 g/mol. Its IUPAC name is 9-[2,6-bis(2,3,5,6-tetrahydro-1,4,7-benzotrioxonin-9-yl)pyrylium-4-yl]-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine.
| Compound Name | 9-[2,6-bis(2,3,5,6-tetrahydro-1,4,7-benzotrioxonin-9-yl)pyrylium-4-yl]-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine |
|---|---|
| PubChem CID | 102211345 |
| Molecular Formula | C35H35O10+ |
| Molecular Weight | 615.65 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | 9-[2,6-bis(2,3,5,6-tetrahydro-1,4,7-benzotrioxonin-9-yl)pyrylium-4-yl]-2,3,5,6-tetrahydro-1,4,7-benzotrioxonine |
| SMILES | c1cc2c(cc1-c1cc(-c3ccc4c(c3)OCCOCCO4)[o+]c(-c3ccc4c(c3)OCCOCCO4)c1)OCCOCCO2 |
| InChI | InChI=1S/C35H35O10/c1-4-28-33(42-16-10-36-7-13-39-28)19-24(1)27-22-31(25-2-5-29-34(20-25)43-17-11-37-8-14-40-29)45-32(23-27)26-3-6-30-35(21-26)44-18-12-38-9-15-41-30/h1-6,19-23H,7-18H2/q+1 |
| InChIKey | BVWCYUCMMWSGPD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 94.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|