C14H12ClNO2 — CID 81274653
4-chloro-2-(2,3-dihydro-1,4-benzodioxin-6-yl)aniline (PubChem CID 81274653) has the molecular formula C14H12ClNO2 and a molecular weight of 261.71 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydro-1,4-benzodioxin-6-yl)aniline.
| Compound Name | 4-chloro-2-(2,3-dihydro-1,4-benzodioxin-6-yl)aniline |
|---|---|
| PubChem CID | 81274653 |
| Molecular Formula | C14H12ClNO2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 4-chloro-2-(2,3-dihydro-1,4-benzodioxin-6-yl)aniline |
| SMILES | Nc1ccc(Cl)cc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H12ClNO2/c15-10-2-3-12(16)11(8-10)9-1-4-13-14(7-9)18-6-5-17-13/h1-4,7-8H,5-6,16H2 |
| InChIKey | ILINXHNPBODMKI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|