C14H12FNO2 — CID 107602794
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluoroaniline (PubChem CID 107602794) has the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluoroaniline.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluoroaniline |
|---|---|
| PubChem CID | 107602794 |
| Molecular Formula | C14H12FNO2 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-fluoroaniline |
| SMILES | Nc1c(F)cccc1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H12FNO2/c15-11-3-1-2-10(14(11)16)9-4-5-12-13(8-9)18-7-6-17-12/h1-5,8H,6-7,16H2 |
| InChIKey | IPKWANXZLFGESZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|