C21H15ClO5 — CID 12710912
1,3-diphenylisochromenylium perchlorate (PubChem CID 12710912) has the molecular formula C21H15ClO5 and a molecular weight of 382.80 g/mol. Its IUPAC name is 1,3-diphenylisochromenylium perchlorate.
| Compound Name | 1,3-diphenylisochromenylium perchlorate |
|---|---|
| PubChem CID | 12710912 |
| Molecular Formula | C21H15ClO5 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 1,3-diphenylisochromenylium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc3ccccc3c(-c3ccccc3)[o+]2)cc1 |
| InChI | InChI=1S/C21H15O.ClHO4/c1-3-9-16(10-4-1)20-15-18-13-7-8-14-19(18)21(22-20)17-11-5-2-6-12-17;2-1(3,4)5/h1-15H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | RZXPDABEXLMYHN-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|