C25H19ClO4S — CID 3049739
2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium perchlorate (PubChem CID 3049739) has the molecular formula C25H19ClO4S and a molecular weight of 450.94 g/mol. Its IUPAC name is 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium perchlorate.
| Compound Name | 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium perchlorate |
|---|---|
| PubChem CID | 3049739 |
| Molecular Formula | C25H19ClO4S |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 2,4-diphenyl-5,6-dihydrobenzo[h]thiochromen-1-ium perchlorate |
| SMILES | [O-][Cl+3]([O-])([O-])[O-].c1ccc(-c2cc(-c3ccccc3)c3c([s+]2)-c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C25H19S.ClHO4/c1-3-9-18(10-4-1)23-17-24(20-12-5-2-6-13-20)26-25-21-14-8-7-11-19(21)15-16-22(23)25;2-1(3,4)5/h1-14,17H,15-16H2;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | VLJJFNGMCRUEAD-UHFFFAOYSA-M |
| XLogP | 2.37 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|