C23H16Cl2O4S — CID 86223340
4-(4-chlorophenyl)-2,6-diphenylthiopyrylium perchlorate (PubChem CID 86223340) has the molecular formula C23H16Cl2O4S and a molecular weight of 459.35 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-diphenylthiopyrylium perchlorate.
| Compound Name | 4-(4-chlorophenyl)-2,6-diphenylthiopyrylium perchlorate |
|---|---|
| PubChem CID | 86223340 |
| Molecular Formula | C23H16Cl2O4S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-diphenylthiopyrylium perchlorate |
| SMILES | Clc1ccc(-c2cc(-c3ccccc3)[s+]c(-c3ccccc3)c2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H16ClS.ClHO4/c24-21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)25-23(16-20)19-9-5-2-6-10-19;2-1(3,4)5/h1-16H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | IODQETKHXRPXPI-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|