C23H13Cl5O5 — CID 14687807
3,5-dichloro-2,6-bis(4-chlorophenyl)-4-phenylpyrylium perchlorate (PubChem CID 14687807) has the molecular formula C23H13Cl5O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is 3,5-dichloro-2,6-bis(4-chlorophenyl)-4-phenylpyrylium perchlorate.
| Compound Name | 3,5-dichloro-2,6-bis(4-chlorophenyl)-4-phenylpyrylium perchlorate |
|---|---|
| PubChem CID | 14687807 |
| Molecular Formula | C23H13Cl5O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 543.92 |
| IUPAC Name | 3,5-dichloro-2,6-bis(4-chlorophenyl)-4-phenylpyrylium perchlorate |
| SMILES | Clc1ccc(-c2[o+]c(-c3ccc(Cl)cc3)c(Cl)c(-c3ccccc3)c2Cl)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C23H13Cl4O.ClHO4/c24-17-10-6-15(7-11-17)22-20(26)19(14-4-2-1-3-5-14)21(27)23(28-22)16-8-12-18(25)13-9-16;2-1(3,4)5/h1-13H;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | QGIKGNUVANBPHE-UHFFFAOYSA-M |
| XLogP | 4.42 |
| TPSA | 103.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|