C48H28Cl4 — CID 102232436
1,4,9,12-tetrakis(4-chlorophenyl)tetraphenylene (PubChem CID 102232436) has the molecular formula C48H28Cl4 and a molecular weight of 746.56 g/mol. Its IUPAC name is 1,4,9,12-tetrakis(4-chlorophenyl)tetraphenylene.
| Compound Name | 1,4,9,12-tetrakis(4-chlorophenyl)tetraphenylene |
|---|---|
| PubChem CID | 102232436 |
| Molecular Formula | C48H28Cl4 |
| Molecular Weight | 746.56 g/mol |
| Exact Mass | 744.09 |
| IUPAC Name | 1,4,9,12-tetrakis(4-chlorophenyl)tetraphenylene |
| SMILES | Clc1ccc(-c2ccc(-c3ccc(Cl)cc3)c3c2-c2ccccc2-c2c(-c4ccc(Cl)cc4)ccc(-c4ccc(Cl)cc4)c2-c2ccccc2-3)cc1 |
| InChI | InChI=1S/C48H28Cl4/c49-33-17-9-29(10-18-33)37-25-26-39(31-13-21-35(51)22-14-31)47-43-7-3-4-8-44(43)48-40(32-15-23-36(52)24-16-32)28-27-38(30-11-19-34(50)20-12-30)46(48)42-6-2-1-5-41(42)45(37)47/h1-28H/b45-41-,46-42-,47-43-,48-44- |
| InChIKey | WWLAHDHMCBZINB-UGTUTOIASA-N |
| XLogP | 15.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.56 |
| LogP ≤ 5 | 15.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |