C18H13BrCl2S — CID 173089955
2,3-bis(4-chlorophenyl)benzenethiol;hydrobromide (PubChem CID 173089955) has the molecular formula C18H13BrCl2S and a molecular weight of 412.18 g/mol. Its IUPAC name is 2,3-bis(4-chlorophenyl)benzenethiol;hydrobromide.
| Compound Name | 2,3-bis(4-chlorophenyl)benzenethiol;hydrobromide |
|---|---|
| PubChem CID | 173089955 |
| Molecular Formula | C18H13BrCl2S |
| Molecular Weight | 412.18 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | 2,3-bis(4-chlorophenyl)benzenethiol;hydrobromide |
| SMILES | Br.Sc1cccc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2S.BrH/c19-14-8-4-12(5-9-14)16-2-1-3-17(21)18(16)13-6-10-15(20)11-7-13;/h1-11,21H;1H |
| InChIKey | ROYKQTNGCZURMM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.18 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|