C20H17ClSi — CID 155787437
1-(4-chlorophenyl)-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 155787437) has the molecular formula C20H17ClSi and a molecular weight of 320.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 1-(4-chlorophenyl)-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 155787437 |
| Molecular Formula | C20H17ClSi |
| Molecular Weight | 320.90 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-(4-chlorophenyl)-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccc(Cl)cc3)cccc21 |
| InChI | InChI=1S/C20H17ClSi/c1-22(2)18-8-4-3-6-17(18)20-16(7-5-9-19(20)22)14-10-12-15(21)13-11-14/h3-13H,1-2H3 |
| InChIKey | NGFNZHQHWOWGIR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|