C18H22Si — CID 168834764
1-tert-butyl-5,5-dimethylbenzo[b][1]benzosilole (PubChem CID 168834764) has the molecular formula C18H22Si and a molecular weight of 266.46 g/mol. Its IUPAC name is 1-tert-butyl-5,5-dimethylbenzo[b][1]benzosilole.
| Compound Name | 1-tert-butyl-5,5-dimethylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 168834764 |
| Molecular Formula | C18H22Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-tert-butyl-5,5-dimethylbenzo[b][1]benzosilole |
| SMILES | CC(C)(C)c1cccc2c1-c1ccccc1[Si]2(C)C |
| InChI | InChI=1S/C18H22Si/c1-18(2,3)14-10-8-12-16-17(14)13-9-6-7-11-15(13)19(16,4)5/h6-12H,1-5H3 |
| InChIKey | BZGROUPRDWDUMN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|