C22H18O3Si — CID 90729792
2-(5,5-dimethylbenzo[b][1]benzosilole-1-carbonyl)benzoic acid (PubChem CID 90729792) has the molecular formula C22H18O3Si and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-(5,5-dimethylbenzo[b][1]benzosilole-1-carbonyl)benzoic acid.
| Compound Name | 2-(5,5-dimethylbenzo[b][1]benzosilole-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 90729792 |
| Molecular Formula | C22H18O3Si |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-(5,5-dimethylbenzo[b][1]benzosilole-1-carbonyl)benzoic acid |
| SMILES | C[Si]1(C)c2ccccc2-c2c(C(=O)c3ccccc3C(=O)O)cccc21 |
| InChI | InChI=1S/C22H18O3Si/c1-26(2)18-12-6-5-10-16(18)20-17(11-7-13-19(20)26)21(23)14-8-3-4-9-15(14)22(24)25/h3-13H,1-2H3,(H,24,25) |
| InChIKey | RUBUCRJSOSNPRK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|