C26H22O6 — CID 141342382
4-[2-(4-carboxy-2,3-dimethylbenzoyl)benzoyl]-2,3-dimethylbenzoic acid (PubChem CID 141342382) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is 4-[2-(4-carboxy-2,3-dimethylbenzoyl)benzoyl]-2,3-dimethylbenzoic acid.
| Compound Name | 4-[2-(4-carboxy-2,3-dimethylbenzoyl)benzoyl]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 141342382 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[2-(4-carboxy-2,3-dimethylbenzoyl)benzoyl]-2,3-dimethylbenzoic acid |
| SMILES | Cc1c(C(=O)O)ccc(C(=O)c2ccccc2C(=O)c2ccc(C(=O)O)c(C)c2C)c1C |
| InChI | InChI=1S/C26H22O6/c1-13-15(3)19(25(29)30)11-9-17(13)23(27)21-7-5-6-8-22(21)24(28)18-10-12-20(26(31)32)16(4)14(18)2/h5-12H,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | SPXKRENQAPTRQK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |