C20H28Si2 — CID 174063391
1-tert-butyl-5,5,10,10-tetramethylsilanthrene (PubChem CID 174063391) has the molecular formula C20H28Si2 and a molecular weight of 324.62 g/mol. Its IUPAC name is 1-tert-butyl-5,5,10,10-tetramethylsilanthrene.
| Compound Name | 1-tert-butyl-5,5,10,10-tetramethylsilanthrene |
|---|---|
| PubChem CID | 174063391 |
| Molecular Formula | C20H28Si2 |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-tert-butyl-5,5,10,10-tetramethylsilanthrene |
| SMILES | CC(C)(C)c1cccc2c1[Si](C)(C)c1ccccc1[Si]2(C)C |
| InChI | InChI=1S/C20H28Si2/c1-20(2,3)15-11-10-14-18-19(15)22(6,7)17-13-9-8-12-16(17)21(18,4)5/h8-14H,1-7H3 |
| InChIKey | YMLICNHKIJQMQJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|