C46H58Si — CID 18792432
2,3,4,5-tetrakis(2-tert-butylphenyl)-1,1-dimethylsilole (PubChem CID 18792432) has the molecular formula C46H58Si and a molecular weight of 639.06 g/mol. Its IUPAC name is 2,3,4,5-tetrakis(2-tert-butylphenyl)-1,1-dimethylsilole.
| Compound Name | 2,3,4,5-tetrakis(2-tert-butylphenyl)-1,1-dimethylsilole |
|---|---|
| PubChem CID | 18792432 |
| Molecular Formula | C46H58Si |
| Molecular Weight | 639.06 g/mol |
| Exact Mass | 638.43 |
| IUPAC Name | 2,3,4,5-tetrakis(2-tert-butylphenyl)-1,1-dimethylsilole |
| SMILES | CC(C)(C)c1ccccc1C1=C(c2ccccc2C(C)(C)C)[Si](C)(C)C(c2ccccc2C(C)(C)C)=C1c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C46H58Si/c1-43(2,3)35-27-19-15-23-31(35)39-40(32-24-16-20-28-36(32)44(4,5)6)42(34-26-18-22-30-38(34)46(10,11)12)47(13,14)41(39)33-25-17-21-29-37(33)45(7,8)9/h15-30H,1-14H3 |
| InChIKey | FVOLWTFUAKRYRY-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.06 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|