C26H28Cl2 — CID 176589272
1,4-bis(2-tert-butylphenyl)-2,5-dichloro-3,6-dideuteriobenzene (PubChem CID 176589272) has the molecular formula C26H28Cl2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 1,4-bis(2-tert-butylphenyl)-2,5-dichloro-3,6-dideuteriobenzene.
| Compound Name | 1,4-bis(2-tert-butylphenyl)-2,5-dichloro-3,6-dideuteriobenzene |
|---|---|
| PubChem CID | 176589272 |
| Molecular Formula | C26H28Cl2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1,4-bis(2-tert-butylphenyl)-2,5-dichloro-3,6-dideuteriobenzene |
| SMILES | [2H]c1c(Cl)c(-c2ccccc2C(C)(C)C)c([2H])c(Cl)c1-c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C26H28Cl2/c1-25(2,3)21-13-9-7-11-17(21)19-15-24(28)20(16-23(19)27)18-12-8-10-14-22(18)26(4,5)6/h7-16H,1-6H3/i15D,16D |
| InChIKey | LDZAVIYCWPCXMB-RAHXUVGXSA-N |
| XLogP | 8.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |