C28H26Si — CID 166012590
4-tert-butyl-5,5-diphenylbenzo[b][1]benzosilole (PubChem CID 166012590) has the molecular formula C28H26Si and a molecular weight of 390.60 g/mol. Its IUPAC name is 4-tert-butyl-5,5-diphenylbenzo[b][1]benzosilole.
| Compound Name | 4-tert-butyl-5,5-diphenylbenzo[b][1]benzosilole |
|---|---|
| PubChem CID | 166012590 |
| Molecular Formula | C28H26Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-tert-butyl-5,5-diphenylbenzo[b][1]benzosilole |
| SMILES | CC(C)(C)c1cccc2c1[Si](c1ccccc1)(c1ccccc1)c1ccccc1-2 |
| InChI | InChI=1S/C28H26Si/c1-28(2,3)25-19-12-18-24-23-17-10-11-20-26(23)29(27(24)25,21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-20H,1-3H3 |
| InChIKey | XMUUVVPXEBNDQR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|