About 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane
1-chloro-2-(4-chlorophenyl)benzene;dichloromethane (PubChem CID 175257983) has the molecular formula C13H10Cl4
and a molecular weight of 308.04 g/mol. Its IUPAC name is 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane.
Molecular Properties
| Compound Name | 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane |
| PubChem CID | 175257983 |
| Molecular Formula | C13H10Cl4 |
| Molecular Weight | 308.04 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane |
| SMILES | ClCCl.Clc1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C12H8Cl2.CH2Cl2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;2-1-3/h1-8H;1H2 |
| InChIKey | DONMEAYKZIGYGD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.04 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane?
The IUPAC name of 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane (CID 175257983) is 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane.
What is the SMILES notation for 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane?
The canonical SMILES for 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane is ClCCl.Clc1ccc(-c2ccccc2Cl)cc1.
What is the InChIKey of 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane?
The InChIKey is DONMEAYKZIGYGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2.CH2Cl2/c13-10-7-5-9(6-8-10)11-3-1-2-4-12(11)14;2-1-3/h1-8H;1H2.
What are the key properties of 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane?
1-chloro-2-(4-chlorophenyl)benzene;dichloromethane has a molecular weight of 308.04 g/mol, XLogP of 6.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(4-chlorophenyl)benzene;dichloromethane is sourced from PubChem (CID 175257983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).