1-chloro-2-phenylbenzene;phosphorous acid

C12H12ClO3P — CID 174579348

IUPAC1-chloro-2-phenylbenzene;phosphorous acid
SMILESClc1ccccc1-c1ccccc1.OP(O)O
InChIInChI=1S/C12H9Cl.H3O3P/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-4(2)3/h1-9H;1-3H
InChIKeyOWUAWMRCPGOBKU-UHFFFAOYSA-N
MW270.65 g/mol
LogP3.20
Rot. Bonds1

About 1-chloro-2-phenylbenzene;phosphorous acid

1-chloro-2-phenylbenzene;phosphorous acid (PubChem CID 174579348) has the molecular formula C12H12ClO3P and a molecular weight of 270.65 g/mol. Its IUPAC name is 1-chloro-2-phenylbenzene;phosphorous acid.

Molecular Properties

Compound Name1-chloro-2-phenylbenzene;phosphorous acid
PubChem CID174579348
Molecular FormulaC12H12ClO3P
Molecular Weight270.65 g/mol
Exact Mass270.02
IUPAC Name1-chloro-2-phenylbenzene;phosphorous acid
SMILESClc1ccccc1-c1ccccc1.OP(O)O
InChIInChI=1S/C12H9Cl.H3O3P/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-4(2)3/h1-9H;1-3H
InChIKeyOWUAWMRCPGOBKU-UHFFFAOYSA-N
XLogP3.20
TPSA60.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.65
LogP ≤ 53.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-chloro-2-phenylbenzene;phosphorous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-2-phenylbenzene;phosphorous acid?
The IUPAC name of 1-chloro-2-phenylbenzene;phosphorous acid (CID 174579348) is 1-chloro-2-phenylbenzene;phosphorous acid.
What is the SMILES notation for 1-chloro-2-phenylbenzene;phosphorous acid?
The canonical SMILES for 1-chloro-2-phenylbenzene;phosphorous acid is Clc1ccccc1-c1ccccc1.OP(O)O.
What is the InChIKey of 1-chloro-2-phenylbenzene;phosphorous acid?
The InChIKey is OWUAWMRCPGOBKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl.H3O3P/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-4(2)3/h1-9H;1-3H.
What are the key properties of 1-chloro-2-phenylbenzene;phosphorous acid?
1-chloro-2-phenylbenzene;phosphorous acid has a molecular weight of 270.65 g/mol, XLogP of 3.20, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-phenylbenzene;phosphorous acid is sourced from PubChem (CID 174579348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).