C28H23Cl2NO4S — CID 10840169
2-[4-(4-chlorophenyl)-2,6-diphenylphenyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium perchlorate (PubChem CID 10840169) has the molecular formula C28H23Cl2NO4S and a molecular weight of 540.47 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-2,6-diphenylphenyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium perchlorate.
| Compound Name | 2-[4-(4-chlorophenyl)-2,6-diphenylphenyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium perchlorate |
|---|---|
| PubChem CID | 10840169 |
| Molecular Formula | C28H23Cl2NO4S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-2,6-diphenylphenyl]-3-methyl-4,5-dihydro-1,3-thiazol-3-ium perchlorate |
| SMILES | C[N+]1=C(c2c(-c3ccccc3)cc(-c3ccc(Cl)cc3)cc2-c2ccccc2)SCC1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C28H23ClNS.ClHO4/c1-30-16-17-31-28(30)27-25(21-8-4-2-5-9-21)18-23(20-12-14-24(29)15-13-20)19-26(27)22-10-6-3-7-11-22;2-1(3,4)5/h2-15,18-19H,16-17H2,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | BVIHAOWEJOWEQC-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|