C34H24Cl3NO4 — CID 10031768
2-[2,6-bis(4-chlorophenyl)-4-phenylphenyl]-1-methylquinolin-1-ium perchlorate (PubChem CID 10031768) has the molecular formula C34H24Cl3NO4 and a molecular weight of 616.93 g/mol. Its IUPAC name is 2-[2,6-bis(4-chlorophenyl)-4-phenylphenyl]-1-methylquinolin-1-ium perchlorate.
| Compound Name | 2-[2,6-bis(4-chlorophenyl)-4-phenylphenyl]-1-methylquinolin-1-ium perchlorate |
|---|---|
| PubChem CID | 10031768 |
| Molecular Formula | C34H24Cl3NO4 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 615.08 |
| IUPAC Name | 2-[2,6-bis(4-chlorophenyl)-4-phenylphenyl]-1-methylquinolin-1-ium perchlorate |
| SMILES | C[n+]1c(-c2c(-c3ccc(Cl)cc3)cc(-c3ccccc3)cc2-c2ccc(Cl)cc2)ccc2ccccc21.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C34H24Cl2N.ClHO4/c1-37-32-10-6-5-9-26(32)15-20-33(37)34-30(24-11-16-28(35)17-12-24)21-27(23-7-3-2-4-8-23)22-31(34)25-13-18-29(36)19-14-25;2-1(3,4)5/h2-22H,1H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | WBECPCBXYMYWLK-UHFFFAOYSA-M |
| XLogP | 4.88 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|