C31H26NO+ — CID 10482035
2-[4-(4-methoxyphenyl)-2,6-diphenylphenyl]-1-methylpyridin-1-ium (PubChem CID 10482035) has the molecular formula C31H26NO+ and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-2,6-diphenylphenyl]-1-methylpyridin-1-ium.
| Compound Name | 2-[4-(4-methoxyphenyl)-2,6-diphenylphenyl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 10482035 |
| Molecular Formula | C31H26NO+ |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-2,6-diphenylphenyl]-1-methylpyridin-1-ium |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(-c3cccc[n+]3C)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C31H26NO/c1-32-20-10-9-15-30(32)31-28(24-11-5-3-6-12-24)21-26(23-16-18-27(33-2)19-17-23)22-29(31)25-13-7-4-8-14-25/h3-22H,1-2H3/q+1 |
| InChIKey | UJSNGTVKHXXBLM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|